C16H12BrN5 — CID 25117506
4-[[bromo(phenyl)methyl]-(1,2,4-triazol-4-yl)amino]benzonitrile (PubChem CID 25117506) has the molecular formula C16H12BrN5 and a molecular weight of 354.21 g/mol. Its IUPAC name is 4-[[bromo(phenyl)methyl]-(1,2,4-triazol-4-yl)amino]benzonitrile.
| Compound Name | 4-[[bromo(phenyl)methyl]-(1,2,4-triazol-4-yl)amino]benzonitrile |
|---|---|
| PubChem CID | 25117506 |
| Molecular Formula | C16H12BrN5 |
| Molecular Weight | 354.21 g/mol |
| Exact Mass | 353.03 |
| IUPAC Name | 4-[[bromo(phenyl)methyl]-(1,2,4-triazol-4-yl)amino]benzonitrile |
| SMILES | N#Cc1ccc(N(C(Br)c2ccccc2)n2cnnc2)cc1 |
| InChI | InChI=1S/C16H12BrN5/c17-16(14-4-2-1-3-5-14)22(21-11-19-20-12-21)15-8-6-13(10-18)7-9-15/h1-9,11-12,16H |
| InChIKey | QFXHQJQIOOGLKY-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 57.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.21 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|