C45H27N13 — CID 67478111
4-(N-[7,11-bis(N-(4-cyanophenyl)anilino)-2,4,6,8,10,12,13-heptazatricyclo[7.3.1.05,13]trideca-1,3,5,7,9,11-hexaen-3-yl]anilino)benzonitrile (PubChem CID 67478111) has the molecular formula C45H27N13 and a molecular weight of 749.80 g/mol. Its IUPAC name is 4-(N-[7,11-bis(N-(4-cyanophenyl)anilino)-2,4,6,8,10,12,13-heptazatricyclo[7.3.1.05,13]trideca-1,3,5,7,9,11-hexaen-3-yl]anilino)benzonitrile.
| Compound Name | 4-(N-[7,11-bis(N-(4-cyanophenyl)anilino)-2,4,6,8,10,12,13-heptazatricyclo[7.3.1.05,13]trideca-1,3,5,7,9,11-hexaen-3-yl]anilino)benzonitrile |
|---|---|
| PubChem CID | 67478111 |
| Molecular Formula | C45H27N13 |
| Molecular Weight | 749.80 g/mol |
| Exact Mass | 749.25 |
| IUPAC Name | 4-(N-[7,11-bis(N-(4-cyanophenyl)anilino)-2,4,6,8,10,12,13-heptazatricyclo[7.3.1.05,13]trideca-1,3,5,7,9,11-hexaen-3-yl]anilino)benzonitrile |
| SMILES | N#Cc1ccc(N(C2=NC3=NC(N(c4ccccc4)c4ccc(C#N)cc4)=NC4=NC(N(c5ccccc5)c5ccc(C#N)cc5)=NC(=N2)N34)c2ccccc2)cc1 |
| InChI | InChI=1S/C45H27N13/c46-28-31-16-22-37(23-17-31)55(34-10-4-1-5-11-34)40-49-43-51-41(56(35-12-6-2-7-13-35)38-24-18-32(29-47)19-25-38)53-45-54-42(52-44(50-40)58(43)45)57(36-14-8-3-9-15-36)39-26-20-33(30-48)21-27-39/h1-27H |
| InChIKey | IYXFUYPVNYQAEO-UHFFFAOYSA-N |
| XLogP | 8.60 |
| TPSA | 158.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 58 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 749.80 |
| LogP ≤ 5 | 8.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |