C18H13ClFN5O3S — CID 25121987
3-chloro-5-[2-fluoro-3-[(4-methyl-5-methylsulfanyl-1,2,4-triazol-3-yl)methyl]-6-nitrophenoxy]benzonitrile (PubChem CID 25121987) has the molecular formula C18H13ClFN5O3S and a molecular weight of 433.85 g/mol. Its IUPAC name is 3-chloro-5-[2-fluoro-3-[(4-methyl-5-methylsulfanyl-1,2,4-triazol-3-yl)methyl]-6-nitrophenoxy]benzonitrile.
| Compound Name | 3-chloro-5-[2-fluoro-3-[(4-methyl-5-methylsulfanyl-1,2,4-triazol-3-yl)methyl]-6-nitrophenoxy]benzonitrile |
|---|---|
| PubChem CID | 25121987 |
| Molecular Formula | C18H13ClFN5O3S |
| Molecular Weight | 433.85 g/mol |
| Exact Mass | 433.04 |
| IUPAC Name | 3-chloro-5-[2-fluoro-3-[(4-methyl-5-methylsulfanyl-1,2,4-triazol-3-yl)methyl]-6-nitrophenoxy]benzonitrile |
| SMILES | CSc1nnc(Cc2ccc([N+](=O)[O-])c(Oc3cc(Cl)cc(C#N)c3)c2F)n1C |
| InChI | InChI=1S/C18H13ClFN5O3S/c1-24-15(22-23-18(24)29-2)7-11-3-4-14(25(26)27)17(16(11)20)28-13-6-10(9-21)5-12(19)8-13/h3-6,8H,7H2,1-2H3 |
| InChIKey | PCXKULOSLNOTGN-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 106.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.85 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|