C18H26O3 — CID 25131802
ethyl (2R,3aR,7aS)-3-oxo-2,3a-bis(prop-2-enyl)-1,4,5,6,7,7a-hexahydroindene-2-carboxylate (PubChem CID 25131802) has the molecular formula C18H26O3 and a molecular weight of 290.40 g/mol. Its IUPAC name is ethyl (2R,3aR,7aS)-3-oxo-2,3a-bis(prop-2-enyl)-1,4,5,6,7,7a-hexahydroindene-2-carboxylate.
| Compound Name | ethyl (2R,3aR,7aS)-3-oxo-2,3a-bis(prop-2-enyl)-1,4,5,6,7,7a-hexahydroindene-2-carboxylate |
|---|---|
| PubChem CID | 25131802 |
| Molecular Formula | C18H26O3 |
| Molecular Weight | 290.40 g/mol |
| Exact Mass | 290.19 |
| IUPAC Name | ethyl (2R,3aR,7aS)-3-oxo-2,3a-bis(prop-2-enyl)-1,4,5,6,7,7a-hexahydroindene-2-carboxylate |
| SMILES | C=CC[C@@]1(C(=O)OCC)C[C@@H]2CCCC[C@]2(CC=C)C1=O |
| InChI | InChI=1S/C18H26O3/c1-4-10-17-12-8-7-9-14(17)13-18(11-5-2,15(17)19)16(20)21-6-3/h4-5,14H,1-2,6-13H2,3H3/t14-,17-,18+/m0/s1 |
| InChIKey | RVTQEFOBVKKOGB-JCGIZDLHSA-N |
| XLogP | 3.84 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.40 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|