C14H10N4O5S2 — CID 25137976
4-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-(5-nitrothiophen-2-yl)sulfanyl-1H-1,2,4-triazol-5-one (PubChem CID 25137976) has the molecular formula C14H10N4O5S2 and a molecular weight of 378.39 g/mol. Its IUPAC name is 4-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-(5-nitrothiophen-2-yl)sulfanyl-1H-1,2,4-triazol-5-one.
| Compound Name | 4-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-(5-nitrothiophen-2-yl)sulfanyl-1H-1,2,4-triazol-5-one |
|---|---|
| PubChem CID | 25137976 |
| Molecular Formula | C14H10N4O5S2 |
| Molecular Weight | 378.39 g/mol |
| Exact Mass | 378.01 |
| IUPAC Name | 4-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-(5-nitrothiophen-2-yl)sulfanyl-1H-1,2,4-triazol-5-one |
| SMILES | O=c1[nH]nc(Sc2ccc([N+](=O)[O-])s2)n1-c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C14H10N4O5S2/c19-13-15-16-14(25-12-4-3-11(24-12)18(20)21)17(13)8-1-2-9-10(7-8)23-6-5-22-9/h1-4,7H,5-6H2,(H,15,19) |
| InChIKey | XVBXUPPITMGMCB-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 112.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.39 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|