C19H17NO2 — CID 25138413
4-[[3-[(E)-2-phenylethenyl]-4,5-dihydro-1,2-oxazol-5-yl]methyl]benzaldehyde (PubChem CID 25138413) has the molecular formula C19H17NO2 and a molecular weight of 291.35 g/mol. Its IUPAC name is 4-[[3-[(E)-2-phenylethenyl]-4,5-dihydro-1,2-oxazol-5-yl]methyl]benzaldehyde.
| Compound Name | 4-[[3-[(E)-2-phenylethenyl]-4,5-dihydro-1,2-oxazol-5-yl]methyl]benzaldehyde |
|---|---|
| PubChem CID | 25138413 |
| Molecular Formula | C19H17NO2 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.13 |
| IUPAC Name | 4-[[3-[(E)-2-phenylethenyl]-4,5-dihydro-1,2-oxazol-5-yl]methyl]benzaldehyde |
| SMILES | O=Cc1ccc(CC2CC(/C=C/c3ccccc3)=NO2)cc1 |
| InChI | InChI=1S/C19H17NO2/c21-14-17-8-6-16(7-9-17)12-19-13-18(20-22-19)11-10-15-4-2-1-3-5-15/h1-11,14,19H,12-13H2/b11-10+ |
| InChIKey | RZSARONCOMBRBN-ZHACJKMWSA-N |
| XLogP | 3.90 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|