C31H58O4Si2 — CID 25146468
tert-butyl-[(1S,2S)-2-[tert-butyl(dimethyl)silyl]oxy-1-[(4R,5S,6S)-2,2,5-trimethyl-6-[(2E,4E)-4-methylhexa-2,4-dien-2-yl]-1,3-dioxan-4-yl]pent-4-ynoxy]-dimethylsilane (PubChem CID 25146468) has the molecular formula C31H58O4Si2 and a molecular weight of 550.97 g/mol. Its IUPAC name is tert-butyl-[(1S,2S)-2-[tert-butyl(dimethyl)silyl]oxy-1-[(4R,5S,6S)-2,2,5-trimethyl-6-[(2E,4E)-4-methylhexa-2,4-dien-2-yl]-1,3-dioxan-4-yl]pent-4-ynoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(1S,2S)-2-[tert-butyl(dimethyl)silyl]oxy-1-[(4R,5S,6S)-2,2,5-trimethyl-6-[(2E,4E)-4-methylhexa-2,4-dien-2-yl]-1,3-dioxan-4-yl]pent-4-ynoxy]-dimethylsilane |
|---|---|
| PubChem CID | 25146468 |
| Molecular Formula | C31H58O4Si2 |
| Molecular Weight | 550.97 g/mol |
| Exact Mass | 550.39 |
| IUPAC Name | tert-butyl-[(1S,2S)-2-[tert-butyl(dimethyl)silyl]oxy-1-[(4R,5S,6S)-2,2,5-trimethyl-6-[(2E,4E)-4-methylhexa-2,4-dien-2-yl]-1,3-dioxan-4-yl]pent-4-ynoxy]-dimethylsilane |
| SMILES | C#CC[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1OC(C)(C)O[C@H](/C(C)=C/C(C)=C/C)[C@@H]1C |
| InChI | InChI=1S/C31H58O4Si2/c1-18-20-25(34-36(14,15)29(6,7)8)28(35-37(16,17)30(9,10)11)27-24(5)26(32-31(12,13)33-27)23(4)21-22(3)19-2/h1,19,21,24-28H,20H2,2-17H3/b22-19+,23-21+/t24-,25-,26+,27+,28+/m0/s1 |
| InChIKey | WUPYCJXWCFGZOU-LYIONDSPSA-N |
| XLogP | 8.86 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.97 |
| LogP ≤ 5 | 8.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|