C38H70O5Si2 — CID 102263058
(2S,3S,6S,8R,9S)-8-[(2E,4E,6S,7R)-6,8-bis[[tert-butyl(dimethyl)silyl]oxy]-3,7-dimethylocta-2,4-dienyl]-3-butyl-2-ethynyl-9-methyl-1,7-dioxaspiro[5.5]undecan-3-ol (PubChem CID 102263058) has the molecular formula C38H70O5Si2 and a molecular weight of 663.14 g/mol. Its IUPAC name is (2S,3S,6S,8R,9S)-8-[(2E,4E,6S,7R)-6,8-bis[[tert-butyl(dimethyl)silyl]oxy]-3,7-dimethylocta-2,4-dienyl]-3-butyl-2-ethynyl-9-methyl-1,7-dioxaspiro[5.5]undecan-3-ol.
| Compound Name | (2S,3S,6S,8R,9S)-8-[(2E,4E,6S,7R)-6,8-bis[[tert-butyl(dimethyl)silyl]oxy]-3,7-dimethylocta-2,4-dienyl]-3-butyl-2-ethynyl-9-methyl-1,7-dioxaspiro[5.5]undecan-3-ol |
|---|---|
| PubChem CID | 102263058 |
| Molecular Formula | C38H70O5Si2 |
| Molecular Weight | 663.14 g/mol |
| Exact Mass | 662.48 |
| IUPAC Name | (2S,3S,6S,8R,9S)-8-[(2E,4E,6S,7R)-6,8-bis[[tert-butyl(dimethyl)silyl]oxy]-3,7-dimethylocta-2,4-dienyl]-3-butyl-2-ethynyl-9-methyl-1,7-dioxaspiro[5.5]undecan-3-ol |
| SMILES | C#C[C@@H]1O[C@@]2(CC[C@H](C)[C@@H](C/C=C(C)/C=C/[C@H](O[Si](C)(C)C(C)(C)C)[C@H](C)CO[Si](C)(C)C(C)(C)C)O2)CC[C@@]1(O)CCCC |
| InChI | InChI=1S/C38H70O5Si2/c1-16-18-24-37(39)26-27-38(42-34(37)17-2)25-23-30(4)32(41-38)21-19-29(3)20-22-33(43-45(14,15)36(9,10)11)31(5)28-40-44(12,13)35(6,7)8/h2,19-20,22,30-34,39H,16,18,21,23-28H2,1,3-15H3/b22-20+,29-19+/t30-,31+,32+,33-,34-,37-,38-/m0/s1 |
| InChIKey | PZQMXPKELNFQRD-QELVYEEOSA-N |
| XLogP | 10.17 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.14 |
| LogP ≤ 5 | 10.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|