C29H50O4Si — CID 51050986
(2S,3S,4E,6E)-3-[tert-butyl(dimethyl)silyl]oxy-8-[(2R,3S,6S,8R,9S)-2-ethynyl-3,9-dimethyl-1,7-dioxaspiro[5.5]undecan-8-yl]-2,6-dimethylocta-4,6-dien-1-ol (PubChem CID 51050986) has the molecular formula C29H50O4Si and a molecular weight of 490.80 g/mol. Its IUPAC name is (2S,3S,4E,6E)-3-[tert-butyl(dimethyl)silyl]oxy-8-[(2R,3S,6S,8R,9S)-2-ethynyl-3,9-dimethyl-1,7-dioxaspiro[5.5]undecan-8-yl]-2,6-dimethylocta-4,6-dien-1-ol.
| Compound Name | (2S,3S,4E,6E)-3-[tert-butyl(dimethyl)silyl]oxy-8-[(2R,3S,6S,8R,9S)-2-ethynyl-3,9-dimethyl-1,7-dioxaspiro[5.5]undecan-8-yl]-2,6-dimethylocta-4,6-dien-1-ol |
|---|---|
| PubChem CID | 51050986 |
| Molecular Formula | C29H50O4Si |
| Molecular Weight | 490.80 g/mol |
| Exact Mass | 490.35 |
| IUPAC Name | (2S,3S,4E,6E)-3-[tert-butyl(dimethyl)silyl]oxy-8-[(2R,3S,6S,8R,9S)-2-ethynyl-3,9-dimethyl-1,7-dioxaspiro[5.5]undecan-8-yl]-2,6-dimethylocta-4,6-dien-1-ol |
| SMILES | C#C[C@@H]1O[C@]2(CC[C@@H]1C)CC[C@H](C)[C@@H](C/C=C(C)/C=C/[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)CO)O2 |
| InChI | InChI=1S/C29H50O4Si/c1-11-25-22(3)16-18-29(31-25)19-17-23(4)26(32-29)14-12-21(2)13-15-27(24(5)20-30)33-34(9,10)28(6,7)8/h1,12-13,15,22-27,30H,14,16-20H2,2-10H3/b15-13+,21-12+/t22-,23-,24-,25-,26+,27-,29-/m0/s1 |
| InChIKey | MERLFFVKLGGKPI-UMTVNAGQSA-N |
| XLogP | 6.86 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.80 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|