C18H18ClKN2O3S3 — CID 25148298
potassium N-[[4-[(4-chlorophenyl)methylsulfonyl]-3-phenylbutanoyl]amino]carbamodithioate (PubChem CID 25148298) has the molecular formula C18H18ClKN2O3S3 and a molecular weight of 481.11 g/mol. Its IUPAC name is potassium N-[[4-[(4-chlorophenyl)methylsulfonyl]-3-phenylbutanoyl]amino]carbamodithioate.
| Compound Name | potassium N-[[4-[(4-chlorophenyl)methylsulfonyl]-3-phenylbutanoyl]amino]carbamodithioate |
|---|---|
| PubChem CID | 25148298 |
| Molecular Formula | C18H18ClKN2O3S3 |
| Molecular Weight | 481.11 g/mol |
| Exact Mass | 479.98 |
| IUPAC Name | potassium N-[[4-[(4-chlorophenyl)methylsulfonyl]-3-phenylbutanoyl]amino]carbamodithioate |
| SMILES | O=C(CC(CS(=O)(=O)Cc1ccc(Cl)cc1)c1ccccc1)NNC(=S)[S-].[K+] |
| InChI | InChI=1S/C18H19ClN2O3S3.K/c19-16-8-6-13(7-9-16)11-27(23,24)12-15(14-4-2-1-3-5-14)10-17(22)20-21-18(25)26;/h1-9,15H,10-12H2,(H,20,22)(H2,21,25,26);/q;+1/p-1 |
| InChIKey | AXAQPCHLKOANPE-UHFFFAOYSA-M |
| XLogP | -0.11 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.11 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|