C27H20Cl4N4O2 — CID 25149717
5-(4-chlorophenyl)-N'-[1-(4-chlorophenyl)cyclopropanecarbonyl]-1-(2,4-dichlorophenyl)-4-methylpyrazole-3-carbohydrazide (PubChem CID 25149717) has the molecular formula C27H20Cl4N4O2 and a molecular weight of 574.30 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-N'-[1-(4-chlorophenyl)cyclopropanecarbonyl]-1-(2,4-dichlorophenyl)-4-methylpyrazole-3-carbohydrazide.
| Compound Name | 5-(4-chlorophenyl)-N'-[1-(4-chlorophenyl)cyclopropanecarbonyl]-1-(2,4-dichlorophenyl)-4-methylpyrazole-3-carbohydrazide |
|---|---|
| PubChem CID | 25149717 |
| Molecular Formula | C27H20Cl4N4O2 |
| Molecular Weight | 574.30 g/mol |
| Exact Mass | 572.03 |
| IUPAC Name | 5-(4-chlorophenyl)-N'-[1-(4-chlorophenyl)cyclopropanecarbonyl]-1-(2,4-dichlorophenyl)-4-methylpyrazole-3-carbohydrazide |
| SMILES | Cc1c(C(=O)NNC(=O)C2(c3ccc(Cl)cc3)CC2)nn(-c2ccc(Cl)cc2Cl)c1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C27H20Cl4N4O2/c1-15-23(25(36)32-33-26(37)27(12-13-27)17-4-8-19(29)9-5-17)34-35(22-11-10-20(30)14-21(22)31)24(15)16-2-6-18(28)7-3-16/h2-11,14H,12-13H2,1H3,(H,32,36)(H,33,37) |
| InChIKey | CSNCJUBIVRGIRV-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.30 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|