C28H30N2O2 — CID 25150921
2-[(3S)-1-[2,2-dideuterio-2-(2,2,3,3,4,6,7-heptadeuterio-1-benzofuran-5-yl)ethyl]pyrrolidin-3-yl]-2,2-diphenylacetamide (PubChem CID 25150921) has the molecular formula C28H30N2O2 and a molecular weight of 435.61 g/mol. Its IUPAC name is 2-[(3S)-1-[2,2-dideuterio-2-(2,2,3,3,4,6,7-heptadeuterio-1-benzofuran-5-yl)ethyl]pyrrolidin-3-yl]-2,2-diphenylacetamide.
| Compound Name | 2-[(3S)-1-[2,2-dideuterio-2-(2,2,3,3,4,6,7-heptadeuterio-1-benzofuran-5-yl)ethyl]pyrrolidin-3-yl]-2,2-diphenylacetamide |
|---|---|
| PubChem CID | 25150921 |
| Molecular Formula | C28H30N2O2 |
| Molecular Weight | 435.61 g/mol |
| Exact Mass | 435.29 |
| IUPAC Name | 2-[(3S)-1-[2,2-dideuterio-2-(2,2,3,3,4,6,7-heptadeuterio-1-benzofuran-5-yl)ethyl]pyrrolidin-3-yl]-2,2-diphenylacetamide |
| SMILES | [2H]c1c([2H])c(C([2H])([2H])CN2CC[C@@H](C(C(N)=O)(c3ccccc3)c3ccccc3)C2)c([2H])c2c1OC([2H])([2H])C2([2H])[2H] |
| InChI | InChI=1S/C28H30N2O2/c29-27(31)28(23-7-3-1-4-8-23,24-9-5-2-6-10-24)25-14-17-30(20-25)16-13-21-11-12-26-22(19-21)15-18-32-26/h1-12,19,25H,13-18,20H2,(H2,29,31)/t25-/m1/s1/i11D,12D,13D2,15D2,18D2,19D |
| InChIKey | HXGBXQDTNZMWGS-BKABGCRVSA-N |
| XLogP | 3.96 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.61 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |