C11H9N5O2S — CID 25154895
6-(benzenesulfonyl)-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine (PubChem CID 25154895) has the molecular formula C11H9N5O2S and a molecular weight of 275.29 g/mol. Its IUPAC name is 6-(benzenesulfonyl)-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine.
| Compound Name | 6-(benzenesulfonyl)-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine |
|---|---|
| PubChem CID | 25154895 |
| Molecular Formula | C11H9N5O2S |
| Molecular Weight | 275.29 g/mol |
| Exact Mass | 275.05 |
| IUPAC Name | 6-(benzenesulfonyl)-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine |
| SMILES | Nc1c(S(=O)(=O)c2ccccc2)cnc2ncnn12 |
| InChI | InChI=1S/C11H9N5O2S/c12-10-9(6-13-11-14-7-15-16(10)11)19(17,18)8-4-2-1-3-5-8/h1-7H,12H2 |
| InChIKey | UTTZKWMLDDJUON-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 103.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.29 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |