C8H9NO2 — CID 25158909
(1R,7S)-6-oxa-4-azatricyclo[5.2.1.01,4]dec-8-en-5-one (PubChem CID 25158909) has the molecular formula C8H9NO2 and a molecular weight of 151.16 g/mol. Its IUPAC name is (1R,7S)-6-oxa-4-azatricyclo[5.2.1.01,4]dec-8-en-5-one.
| Compound Name | (1R,7S)-6-oxa-4-azatricyclo[5.2.1.01,4]dec-8-en-5-one |
|---|---|
| PubChem CID | 25158909 |
| Molecular Formula | C8H9NO2 |
| Molecular Weight | 151.16 g/mol |
| Exact Mass | 151.06 |
| IUPAC Name | (1R,7S)-6-oxa-4-azatricyclo[5.2.1.01,4]dec-8-en-5-one |
| SMILES | O=C1O[C@@H]2C=C[C@@]3(CCN13)C2 |
| InChI | InChI=1S/C8H9NO2/c10-7-9-4-3-8(9)2-1-6(5-8)11-7/h1-2,6H,3-5H2/t6-,8-/m1/s1 |
| InChIKey | QGUXLQRTUQWIIE-HTRCEHHLSA-N |
| XLogP | 0.91 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.16 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|