C9H9BrO3 — CID 15669178
(1S,4R,5R)-4-bromo-5-methyl-3-oxo-2-oxabicyclo[2.2.2]oct-7-ene-5-carbaldehyde (PubChem CID 15669178) has the molecular formula C9H9BrO3 and a molecular weight of 245.07 g/mol. Its IUPAC name is (1S,4R,5R)-4-bromo-5-methyl-3-oxo-2-oxabicyclo[2.2.2]oct-7-ene-5-carbaldehyde.
| Compound Name | (1S,4R,5R)-4-bromo-5-methyl-3-oxo-2-oxabicyclo[2.2.2]oct-7-ene-5-carbaldehyde |
|---|---|
| PubChem CID | 15669178 |
| Molecular Formula | C9H9BrO3 |
| Molecular Weight | 245.07 g/mol |
| Exact Mass | 243.97 |
| IUPAC Name | (1S,4R,5R)-4-bromo-5-methyl-3-oxo-2-oxabicyclo[2.2.2]oct-7-ene-5-carbaldehyde |
| SMILES | C[C@]1(C=O)C[C@H]2C=C[C@]1(Br)C(=O)O2 |
| InChI | InChI=1S/C9H9BrO3/c1-8(5-11)4-6-2-3-9(8,10)7(12)13-6/h2-3,5-6H,4H2,1H3/t6-,8-,9+/m1/s1 |
| InChIKey | PITGKNIVEFDIJA-VDAHYXPESA-N |
| XLogP | 1.21 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.07 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|