C12H14O2 — CID 98162410
(1S,6R,9R,12S)-10-oxatetracyclo[7.3.1.01,6.06,12]tridec-7-en-11-one (PubChem CID 98162410) has the molecular formula C12H14O2 and a molecular weight of 190.24 g/mol. Its IUPAC name is (1S,6R,9R,12S)-10-oxatetracyclo[7.3.1.01,6.06,12]tridec-7-en-11-one.
| Compound Name | (1S,6R,9R,12S)-10-oxatetracyclo[7.3.1.01,6.06,12]tridec-7-en-11-one |
|---|---|
| PubChem CID | 98162410 |
| Molecular Formula | C12H14O2 |
| Molecular Weight | 190.24 g/mol |
| Exact Mass | 190.10 |
| IUPAC Name | (1S,6R,9R,12S)-10-oxatetracyclo[7.3.1.01,6.06,12]tridec-7-en-11-one |
| SMILES | O=C1O[C@H]2C=C[C@@]34CCCC[C@]3(C2)[C@H]14 |
| InChI | InChI=1S/C12H14O2/c13-10-9-11-4-1-2-5-12(9,11)7-8(14-10)3-6-11/h3,6,8-9H,1-2,4-5,7H2/t8-,9+,11+,12-/m0/s1 |
| InChIKey | CXNXNXXGGPRISM-SPFNVWMYSA-N |
| XLogP | 2.05 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.24 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|