C8H6ClNO3 — CID 134857213
(4S,5S)-5-chloro-4-hydroxy-3-oxo-2-oxabicyclo[2.2.2]oct-7-ene-5-carbonitrile (PubChem CID 134857213) has the molecular formula C8H6ClNO3 and a molecular weight of 199.59 g/mol. Its IUPAC name is (4S,5S)-5-chloro-4-hydroxy-3-oxo-2-oxabicyclo[2.2.2]oct-7-ene-5-carbonitrile.
| Compound Name | (4S,5S)-5-chloro-4-hydroxy-3-oxo-2-oxabicyclo[2.2.2]oct-7-ene-5-carbonitrile |
|---|---|
| PubChem CID | 134857213 |
| Molecular Formula | C8H6ClNO3 |
| Molecular Weight | 199.59 g/mol |
| Exact Mass | 199.00 |
| IUPAC Name | (4S,5S)-5-chloro-4-hydroxy-3-oxo-2-oxabicyclo[2.2.2]oct-7-ene-5-carbonitrile |
| SMILES | N#C[C@@]1(Cl)CC2C=C[C@]1(O)C(=O)O2 |
| InChI | InChI=1S/C8H6ClNO3/c9-7(4-10)3-5-1-2-8(7,12)6(11)13-5/h1-2,5,12H,3H2/t5?,7-,8-/m0/s1 |
| InChIKey | CETUXWFYLFBQHJ-TWELXNIESA-N |
| XLogP | 0.10 |
| TPSA | 70.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.59 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|