C8H8ClNO2 — CID 102081882
(1R,4R,5R)-5-chloro-4-hydroxy-2-oxabicyclo[2.2.2]oct-7-ene-5-carbonitrile (PubChem CID 102081882) has the molecular formula C8H8ClNO2 and a molecular weight of 185.61 g/mol. Its IUPAC name is (1R,4R,5R)-5-chloro-4-hydroxy-2-oxabicyclo[2.2.2]oct-7-ene-5-carbonitrile.
| Compound Name | (1R,4R,5R)-5-chloro-4-hydroxy-2-oxabicyclo[2.2.2]oct-7-ene-5-carbonitrile |
|---|---|
| PubChem CID | 102081882 |
| Molecular Formula | C8H8ClNO2 |
| Molecular Weight | 185.61 g/mol |
| Exact Mass | 185.02 |
| IUPAC Name | (1R,4R,5R)-5-chloro-4-hydroxy-2-oxabicyclo[2.2.2]oct-7-ene-5-carbonitrile |
| SMILES | N#C[C@]1(Cl)C[C@@H]2C=C[C@@]1(O)CO2 |
| InChI | InChI=1S/C8H8ClNO2/c9-7(4-10)3-6-1-2-8(7,11)5-12-6/h1-2,6,11H,3,5H2/t6-,7+,8+/m0/s1 |
| InChIKey | NPEOGLMAPNPEIB-XLPZGREQSA-N |
| XLogP | 0.58 |
| TPSA | 53.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.61 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|