C9H11NO — CID 98078998
(1S,8R)-9-oxa-5-azatricyclo[6.2.1.01,5]undeca-2,6-diene (PubChem CID 98078998) has the molecular formula C9H11NO and a molecular weight of 149.19 g/mol. Its IUPAC name is (1S,8R)-9-oxa-5-azatricyclo[6.2.1.01,5]undeca-2,6-diene.
| Compound Name | (1S,8R)-9-oxa-5-azatricyclo[6.2.1.01,5]undeca-2,6-diene |
|---|---|
| PubChem CID | 98078998 |
| Molecular Formula | C9H11NO |
| Molecular Weight | 149.19 g/mol |
| Exact Mass | 149.08 |
| IUPAC Name | (1S,8R)-9-oxa-5-azatricyclo[6.2.1.01,5]undeca-2,6-diene |
| SMILES | C1=C[C@@]23CO[C@@H](C=CN2C1)C3 |
| InChI | InChI=1S/C9H11NO/c1-3-9-6-8(11-7-9)2-5-10(9)4-1/h1-3,5,8H,4,6-7H2/t8-,9+/m0/s1 |
| InChIKey | PQJLDXMPEKUXFS-DTWKUNHWSA-N |
| XLogP | 0.91 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.19 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|