C27H35F3N4O6 — CID 25160199
(2S)-6-amino-2-[[(2R)-1-oxo-3-phenyl-1-(2-phenylpropylamino)propan-2-yl]carbamoylamino]hexanoic acid;2,2,2-trifluoroacetic acid (PubChem CID 25160199) has the molecular formula C27H35F3N4O6 and a molecular weight of 568.59 g/mol. Its IUPAC name is (2S)-6-amino-2-[[(2R)-1-oxo-3-phenyl-1-(2-phenylpropylamino)propan-2-yl]carbamoylamino]hexanoic acid;2,2,2-trifluoroacetic acid.
| Compound Name | (2S)-6-amino-2-[[(2R)-1-oxo-3-phenyl-1-(2-phenylpropylamino)propan-2-yl]carbamoylamino]hexanoic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 25160199 |
| Molecular Formula | C27H35F3N4O6 |
| Molecular Weight | 568.59 g/mol |
| Exact Mass | 568.25 |
| IUPAC Name | (2S)-6-amino-2-[[(2R)-1-oxo-3-phenyl-1-(2-phenylpropylamino)propan-2-yl]carbamoylamino]hexanoic acid;2,2,2-trifluoroacetic acid |
| SMILES | CC(CNC(=O)[C@@H](Cc1ccccc1)NC(=O)N[C@@H](CCCCN)C(=O)O)c1ccccc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C25H34N4O4.C2HF3O2/c1-18(20-12-6-3-7-13-20)17-27-23(30)22(16-19-10-4-2-5-11-19)29-25(33)28-21(24(31)32)14-8-9-15-26;3-2(4,5)1(6)7/h2-7,10-13,18,21-22H,8-9,14-17,26H2,1H3,(H,27,30)(H,31,32)(H2,28,29,33);(H,6,7)/t18?,21-,22+;/m0./s1 |
| InChIKey | OHHWYFFOTYXPFX-JIEDINNASA-N |
| XLogP | 3.03 |
| TPSA | 170.85 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.59 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|