C18H25NOS — CID 25167089
1-(cyclohexylmethyl)spiro[piperidine-4,4'-thieno[3,2-c]pyran] (PubChem CID 25167089) has the molecular formula C18H25NOS and a molecular weight of 303.47 g/mol. Its IUPAC name is 1-(cyclohexylmethyl)spiro[piperidine-4,4'-thieno[3,2-c]pyran].
| Compound Name | 1-(cyclohexylmethyl)spiro[piperidine-4,4'-thieno[3,2-c]pyran] |
|---|---|
| PubChem CID | 25167089 |
| Molecular Formula | C18H25NOS |
| Molecular Weight | 303.47 g/mol |
| Exact Mass | 303.17 |
| IUPAC Name | 1-(cyclohexylmethyl)spiro[piperidine-4,4'-thieno[3,2-c]pyran] |
| SMILES | C1=Cc2sccc2C2(CCN(CC3CCCCC3)CC2)O1 |
| InChI | InChI=1S/C18H25NOS/c1-2-4-15(5-3-1)14-19-10-8-18(9-11-19)16-7-13-21-17(16)6-12-20-18/h6-7,12-13,15H,1-5,8-11,14H2 |
| InChIKey | FFAQRPBBIZKKKZ-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.47 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |