C28H54O3Si2 — CID 25170442
(2E,4E,6E,9R,11S)-9,11-bis[[tert-butyl(dimethyl)silyl]oxy]-2,4,6-trimethyltrideca-2,4,6-trienal (PubChem CID 25170442) has the molecular formula C28H54O3Si2 and a molecular weight of 494.91 g/mol. Its IUPAC name is (2E,4E,6E,9R,11S)-9,11-bis[[tert-butyl(dimethyl)silyl]oxy]-2,4,6-trimethyltrideca-2,4,6-trienal.
| Compound Name | (2E,4E,6E,9R,11S)-9,11-bis[[tert-butyl(dimethyl)silyl]oxy]-2,4,6-trimethyltrideca-2,4,6-trienal |
|---|---|
| PubChem CID | 25170442 |
| Molecular Formula | C28H54O3Si2 |
| Molecular Weight | 494.91 g/mol |
| Exact Mass | 494.36 |
| IUPAC Name | (2E,4E,6E,9R,11S)-9,11-bis[[tert-butyl(dimethyl)silyl]oxy]-2,4,6-trimethyltrideca-2,4,6-trienal |
| SMILES | CC[C@@H](C[C@@H](C/C=C(C)/C=C(C)/C=C(\C)C=O)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C28H54O3Si2/c1-15-25(30-32(11,12)27(5,6)7)20-26(31-33(13,14)28(8,9)10)17-16-22(2)18-23(3)19-24(4)21-29/h16,18-19,21,25-26H,15,17,20H2,1-14H3/b22-16+,23-18+,24-19+/t25-,26+/m0/s1 |
| InChIKey | LWXFXAVQSQHQLS-GFGPMXHRSA-N |
| XLogP | 9.00 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.91 |
| LogP ≤ 5 | 9.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|