C11H11N3O3 — CID 25171901
(1R,9S,10S,14R)-13-oxa-2,8,11-triazatetracyclo[7.6.0.02,6.010,14]pentadeca-3,5-diene-7,12-dione (PubChem CID 25171901) has the molecular formula C11H11N3O3 and a molecular weight of 233.23 g/mol. Its IUPAC name is (1R,9S,10S,14R)-13-oxa-2,8,11-triazatetracyclo[7.6.0.02,6.010,14]pentadeca-3,5-diene-7,12-dione.
| Compound Name | (1R,9S,10S,14R)-13-oxa-2,8,11-triazatetracyclo[7.6.0.02,6.010,14]pentadeca-3,5-diene-7,12-dione |
|---|---|
| PubChem CID | 25171901 |
| Molecular Formula | C11H11N3O3 |
| Molecular Weight | 233.23 g/mol |
| Exact Mass | 233.08 |
| IUPAC Name | (1R,9S,10S,14R)-13-oxa-2,8,11-triazatetracyclo[7.6.0.02,6.010,14]pentadeca-3,5-diene-7,12-dione |
| SMILES | O=C1N[C@H]2[C@@H]3NC(=O)c4cccn4[C@@H]3C[C@H]2O1 |
| InChI | InChI=1S/C11H11N3O3/c15-10-5-2-1-3-14(5)6-4-7-9(8(6)12-10)13-11(16)17-7/h1-3,6-9H,4H2,(H,12,15)(H,13,16)/t6-,7-,8-,9-/m1/s1 |
| InChIKey | NRIORDURFSZUFS-FNCVBFRFSA-N |
| XLogP | 0.02 |
| TPSA | 72.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.23 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |