C15H17NO2 — CID 25175080
N-deuterio-N-[2-[7-(trideuteriomethoxy)naphthalen-1-yl]ethyl]acetamide (PubChem CID 25175080) has the molecular formula C15H17NO2 and a molecular weight of 247.33 g/mol. Its IUPAC name is N-deuterio-N-[2-[7-(trideuteriomethoxy)naphthalen-1-yl]ethyl]acetamide.
| Compound Name | N-deuterio-N-[2-[7-(trideuteriomethoxy)naphthalen-1-yl]ethyl]acetamide |
|---|---|
| PubChem CID | 25175080 |
| Molecular Formula | C15H17NO2 |
| Molecular Weight | 247.33 g/mol |
| Exact Mass | 247.15 |
| IUPAC Name | N-deuterio-N-[2-[7-(trideuteriomethoxy)naphthalen-1-yl]ethyl]acetamide |
| SMILES | [2H]N(CCc1cccc2ccc(OC([2H])([2H])[2H])cc12)C(C)=O |
| InChI | InChI=1S/C15H17NO2/c1-11(17)16-9-8-13-5-3-4-12-6-7-14(18-2)10-15(12)13/h3-7,10H,8-9H2,1-2H3,(H,16,17)/i2D3/hD |
| InChIKey | YJYPHIXNFHFHND-GQIQCOLESA-N |
| XLogP | 2.53 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.33 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |