C24H33N3O4 — CID 25183192
benzyl N-[[(2R)-1-[(5-hydroxy-2-adamantyl)carbamoyl]pyrrolidin-2-yl]methyl]carbamate (PubChem CID 25183192) has the molecular formula C24H33N3O4 and a molecular weight of 427.55 g/mol. Its IUPAC name is benzyl N-[[(2R)-1-[(5-hydroxy-2-adamantyl)carbamoyl]pyrrolidin-2-yl]methyl]carbamate.
| Compound Name | benzyl N-[[(2R)-1-[(5-hydroxy-2-adamantyl)carbamoyl]pyrrolidin-2-yl]methyl]carbamate |
|---|---|
| PubChem CID | 25183192 |
| Molecular Formula | C24H33N3O4 |
| Molecular Weight | 427.55 g/mol |
| Exact Mass | 427.25 |
| IUPAC Name | benzyl N-[[(2R)-1-[(5-hydroxy-2-adamantyl)carbamoyl]pyrrolidin-2-yl]methyl]carbamate |
| SMILES | O=C(NC[C@H]1CCCN1C(=O)NC1C2CC3CC1CC(O)(C3)C2)OCc1ccccc1 |
| InChI | InChI=1S/C24H33N3O4/c28-22(26-21-18-9-17-10-19(21)13-24(30,11-17)12-18)27-8-4-7-20(27)14-25-23(29)31-15-16-5-2-1-3-6-16/h1-3,5-6,17-21,30H,4,7-15H2,(H,25,29)(H,26,28)/t17?,18?,19?,20-,21?,24?/m1/s1 |
| InChIKey | QNOLSUTXTKCCOQ-ZEZNOQDWSA-N |
| XLogP | 3.03 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.55 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |