C14H12O2 — CID 25189106
3-benzylpenta-1,2-dien-4-ynyl acetate (PubChem CID 25189106) has the molecular formula C14H12O2 and a molecular weight of 212.25 g/mol. Its IUPAC name is 3-benzylpenta-1,2-dien-4-ynyl acetate.
| Compound Name | 3-benzylpenta-1,2-dien-4-ynyl acetate |
|---|---|
| PubChem CID | 25189106 |
| Molecular Formula | C14H12O2 |
| Molecular Weight | 212.25 g/mol |
| Exact Mass | 212.08 |
| IUPAC Name | 3-benzylpenta-1,2-dien-4-ynyl acetate |
| SMILES | C#CC(=C=COC(C)=O)Cc1ccccc1 |
| InChI | InChI=1S/C14H12O2/c1-3-13(9-10-16-12(2)15)11-14-7-5-4-6-8-14/h1,4-8,10H,11H2,2H3 |
| InChIKey | BNTIRUMUMCVQMR-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.25 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|