About 4-[[3,5-di(propan-2-yl)-1H-pyrrole-2-carbonyl]amino]benzoic acid
4-[[3,5-di(propan-2-yl)-1H-pyrrole-2-carbonyl]amino]benzoic acid (PubChem CID 25189527) has the molecular formula C18H22N2O3
and a molecular weight of 314.39 g/mol. Its IUPAC name is 4-[[3,5-di(propan-2-yl)-1H-pyrrole-2-carbonyl]amino]benzoic acid.
Molecular Properties
| Compound Name | 4-[[3,5-di(propan-2-yl)-1H-pyrrole-2-carbonyl]amino]benzoic acid |
| PubChem CID | 25189527 |
| Molecular Formula | C18H22N2O3 |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.16 |
| IUPAC Name | 4-[[3,5-di(propan-2-yl)-1H-pyrrole-2-carbonyl]amino]benzoic acid |
| SMILES | CC(C)c1cc(C(C)C)c(C(=O)Nc2ccc(C(=O)O)cc2)[nH]1 |
| InChI | InChI=1S/C18H22N2O3/c1-10(2)14-9-15(11(3)4)20-16(14)17(21)19-13-7-5-12(6-8-13)18(22)23/h5-11,20H,1-4H3,(H,19,21)(H,22,23) |
| InChIKey | WXFGJPKSHJTYOU-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-[[3,5-di(propan-2-yl)-1H-pyrrole-2-carbonyl]amino]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[3,5-di(propan-2-yl)-1H-pyrrole-2-carbonyl]amino]benzoic acid?
The IUPAC name of 4-[[3,5-di(propan-2-yl)-1H-pyrrole-2-carbonyl]amino]benzoic acid (CID 25189527) is 4-[[3,5-di(propan-2-yl)-1H-pyrrole-2-carbonyl]amino]benzoic acid.
What is the SMILES notation for 4-[[3,5-di(propan-2-yl)-1H-pyrrole-2-carbonyl]amino]benzoic acid?
The canonical SMILES for 4-[[3,5-di(propan-2-yl)-1H-pyrrole-2-carbonyl]amino]benzoic acid is CC(C)c1cc(C(C)C)c(C(=O)Nc2ccc(C(=O)O)cc2)[nH]1.
What is the InChIKey of 4-[[3,5-di(propan-2-yl)-1H-pyrrole-2-carbonyl]amino]benzoic acid?
The InChIKey is WXFGJPKSHJTYOU-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H22N2O3/c1-10(2)14-9-15(11(3)4)20-16(14)17(21)19-13-7-5-12(6-8-13)18(22)23/h5-11,20H,1-4H3,(H,19,21)(H,22,23).
What are the key properties of 4-[[3,5-di(propan-2-yl)-1H-pyrrole-2-carbonyl]amino]benzoic acid?
4-[[3,5-di(propan-2-yl)-1H-pyrrole-2-carbonyl]amino]benzoic acid has a molecular weight of 314.39 g/mol, XLogP of 4.21, 5 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[3,5-di(propan-2-yl)-1H-pyrrole-2-carbonyl]amino]benzoic acid is sourced from PubChem (CID 25189527), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).