C30H36N4O4 — CID 25197157
(2R,8S)-6-[2-(azepan-1-yl)ethyl]-2-(3-hydroxyphenyl)-13-methoxy-8-methyl-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraene-4,7-dione (PubChem CID 25197157) has the molecular formula C30H36N4O4 and a molecular weight of 516.64 g/mol. Its IUPAC name is (2R,8S)-6-[2-(azepan-1-yl)ethyl]-2-(3-hydroxyphenyl)-13-methoxy-8-methyl-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraene-4,7-dione.
| Compound Name | (2R,8S)-6-[2-(azepan-1-yl)ethyl]-2-(3-hydroxyphenyl)-13-methoxy-8-methyl-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraene-4,7-dione |
|---|---|
| PubChem CID | 25197157 |
| Molecular Formula | C30H36N4O4 |
| Molecular Weight | 516.64 g/mol |
| Exact Mass | 516.27 |
| IUPAC Name | (2R,8S)-6-[2-(azepan-1-yl)ethyl]-2-(3-hydroxyphenyl)-13-methoxy-8-methyl-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraene-4,7-dione |
| SMILES | COc1ccc2[nH]c3c(c2c1)C[C@@]1(C)C(=O)N(CCN2CCCCCC2)CC(=O)N1[C@@H]3c1cccc(O)c1 |
| InChI | InChI=1S/C30H36N4O4/c1-30-18-24-23-17-22(38-2)10-11-25(23)31-27(24)28(20-8-7-9-21(35)16-20)34(30)26(36)19-33(29(30)37)15-14-32-12-5-3-4-6-13-32/h7-11,16-17,28,31,35H,3-6,12-15,18-19H2,1-2H3/t28-,30+/m1/s1 |
| InChIKey | ZBQWGZTTWRFTJN-DGPALRBDSA-N |
| XLogP | 3.83 |
| TPSA | 89.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.64 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|