C31H34O6S — CID 25197744
2-[(2S,3R,5S,6R)-3-[(E)-2-[(S)-(4-methylphenyl)sulfinyl]ethenoxy]-5-phenylmethoxy-6-(phenylmethoxymethyl)oxan-2-yl]acetaldehyde (PubChem CID 25197744) has the molecular formula C31H34O6S and a molecular weight of 534.67 g/mol. Its IUPAC name is 2-[(2S,3R,5S,6R)-3-[(E)-2-[(S)-(4-methylphenyl)sulfinyl]ethenoxy]-5-phenylmethoxy-6-(phenylmethoxymethyl)oxan-2-yl]acetaldehyde.
| Compound Name | 2-[(2S,3R,5S,6R)-3-[(E)-2-[(S)-(4-methylphenyl)sulfinyl]ethenoxy]-5-phenylmethoxy-6-(phenylmethoxymethyl)oxan-2-yl]acetaldehyde |
|---|---|
| PubChem CID | 25197744 |
| Molecular Formula | C31H34O6S |
| Molecular Weight | 534.67 g/mol |
| Exact Mass | 534.21 |
| IUPAC Name | 2-[(2S,3R,5S,6R)-3-[(E)-2-[(S)-(4-methylphenyl)sulfinyl]ethenoxy]-5-phenylmethoxy-6-(phenylmethoxymethyl)oxan-2-yl]acetaldehyde |
| SMILES | Cc1ccc([S@@](=O)/C=C/O[C@@H]2C[C@H](OCc3ccccc3)[C@@H](COCc3ccccc3)O[C@H]2CC=O)cc1 |
| InChI | InChI=1S/C31H34O6S/c1-24-12-14-27(15-13-24)38(33)19-18-35-29-20-30(36-22-26-10-6-3-7-11-26)31(37-28(29)16-17-32)23-34-21-25-8-4-2-5-9-25/h2-15,17-19,28-31H,16,20-23H2,1H3/b19-18+/t28-,29+,30-,31+,38-/m0/s1 |
| InChIKey | DKWGULNHDVIMPM-ILZLVLAESA-N |
| XLogP | 5.51 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.67 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|