C23H24O7S — CID 102148615
2-[(2R,4aR,6S,7R,8aS)-7-[(E)-2-(benzenesulfonyl)ethenoxy]-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl]acetaldehyde (PubChem CID 102148615) has the molecular formula C23H24O7S and a molecular weight of 444.51 g/mol. Its IUPAC name is 2-[(2R,4aR,6S,7R,8aS)-7-[(E)-2-(benzenesulfonyl)ethenoxy]-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl]acetaldehyde.
| Compound Name | 2-[(2R,4aR,6S,7R,8aS)-7-[(E)-2-(benzenesulfonyl)ethenoxy]-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl]acetaldehyde |
|---|---|
| PubChem CID | 102148615 |
| Molecular Formula | C23H24O7S |
| Molecular Weight | 444.51 g/mol |
| Exact Mass | 444.12 |
| IUPAC Name | 2-[(2R,4aR,6S,7R,8aS)-7-[(E)-2-(benzenesulfonyl)ethenoxy]-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl]acetaldehyde |
| SMILES | O=CC[C@@H]1O[C@@H]2CO[C@@H](c3ccccc3)O[C@H]2C[C@H]1O/C=C/S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C23H24O7S/c24-12-11-19-20(27-13-14-31(25,26)18-9-5-2-6-10-18)15-21-22(29-19)16-28-23(30-21)17-7-3-1-4-8-17/h1-10,12-14,19-23H,11,15-16H2/b14-13+/t19-,20+,21-,22+,23+/m0/s1 |
| InChIKey | VKCQJPIHRKYQAM-JILQDHGGSA-N |
| XLogP | 3.18 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.51 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|