C21H22O5S — CID 42599170
2-[(4S,5R)-5-[(E)-2-[(S)-(4-methylphenyl)sulfinyl]ethenoxy]-2-phenyl-1,3-dioxan-4-yl]acetaldehyde (PubChem CID 42599170) has the molecular formula C21H22O5S and a molecular weight of 386.47 g/mol. Its IUPAC name is 2-[(4S,5R)-5-[(E)-2-[(S)-(4-methylphenyl)sulfinyl]ethenoxy]-2-phenyl-1,3-dioxan-4-yl]acetaldehyde.
| Compound Name | 2-[(4S,5R)-5-[(E)-2-[(S)-(4-methylphenyl)sulfinyl]ethenoxy]-2-phenyl-1,3-dioxan-4-yl]acetaldehyde |
|---|---|
| PubChem CID | 42599170 |
| Molecular Formula | C21H22O5S |
| Molecular Weight | 386.47 g/mol |
| Exact Mass | 386.12 |
| IUPAC Name | 2-[(4S,5R)-5-[(E)-2-[(S)-(4-methylphenyl)sulfinyl]ethenoxy]-2-phenyl-1,3-dioxan-4-yl]acetaldehyde |
| SMILES | Cc1ccc([S@@](=O)/C=C/O[C@@H]2COC(c3ccccc3)O[C@H]2CC=O)cc1 |
| InChI | InChI=1S/C21H22O5S/c1-16-7-9-18(10-8-16)27(23)14-13-24-20-15-25-21(26-19(20)11-12-22)17-5-3-2-4-6-17/h2-10,12-14,19-21H,11,15H2,1H3/b14-13+/t19-,20+,21?,27-/m0/s1 |
| InChIKey | ANOOZWRTYVIKSA-OYLRFGBZSA-N |
| XLogP | 3.66 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.47 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|