C30H34O8S — CID 11284315
[(2R,3S,4S,5R,6R)-2-(2-oxoethyl)-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-3-yl] methanesulfonate (PubChem CID 11284315) has the molecular formula C30H34O8S and a molecular weight of 554.66 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6R)-2-(2-oxoethyl)-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-3-yl] methanesulfonate.
| Compound Name | [(2R,3S,4S,5R,6R)-2-(2-oxoethyl)-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-3-yl] methanesulfonate |
|---|---|
| PubChem CID | 11284315 |
| Molecular Formula | C30H34O8S |
| Molecular Weight | 554.66 g/mol |
| Exact Mass | 554.20 |
| IUPAC Name | [(2R,3S,4S,5R,6R)-2-(2-oxoethyl)-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-3-yl] methanesulfonate |
| SMILES | CS(=O)(=O)O[C@@H]1[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@@H](COCc2ccccc2)O[C@@H]1CC=O |
| InChI | InChI=1S/C30H34O8S/c1-39(32,33)38-29-26(17-18-31)37-27(22-34-19-23-11-5-2-6-12-23)28(35-20-24-13-7-3-8-14-24)30(29)36-21-25-15-9-4-10-16-25/h2-16,18,26-30H,17,19-22H2,1H3/t26-,27-,28-,29+,30+/m1/s1 |
| InChIKey | CIVUPZHTCKUIIA-LBEKWILNSA-N |
| XLogP | 4.08 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.66 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|