C27H28FeN2O3+2 — CID 25209732
CID 25209732 (PubChem CID 25209732) has the molecular formula C27H28FeN2O3+2 and a molecular weight of 484.38 g/mol.
| Compound Name | CID 25209732 |
|---|---|
| PubChem CID | 25209732 |
| Molecular Formula | C27H28FeN2O3+2 |
| Molecular Weight | 484.38 g/mol |
| Exact Mass | 484.14 |
| IUPAC Name | — |
| SMILES | CC(C)(C)C(=O)N1[C@@H]([C]2[CH][CH][CH][CH]2)OC(=O)[C@@H]1Cc1c[nH]c2ccccc12.[CH]1[CH][CH][CH][CH]1.[Fe+2] |
| InChI | InChI=1S/C22H23N2O3.C5H5.Fe/c1-22(2,3)21(26)24-18(20(25)27-19(24)14-8-4-5-9-14)12-15-13-23-17-11-7-6-10-16(15)17;1-2-4-5-3-1;/h4-11,13,18-19,23H,12H2,1-3H3;1-5H;/q;;+2/t18-,19+;;/m0../s1 |
| InChIKey | BMTXJFZUCXPUKK-DPSPSOFVSA-N |
| XLogP | 4.26 |
| TPSA | 62.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.38 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|