C22H15ClFN3O2 — CID 25217489
11-[(2-chloro-5-fluoro-3-pyridinyl)methyl]-15-ethyl-8-oxa-6,11-diazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2(7),3,5,12(17),13,15-heptaen-9-one (PubChem CID 25217489) has the molecular formula C22H15ClFN3O2 and a molecular weight of 407.83 g/mol. Its IUPAC name is 11-[(2-chloro-5-fluoro-3-pyridinyl)methyl]-15-ethyl-8-oxa-6,11-diazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2(7),3,5,12(17),13,15-heptaen-9-one.
| Compound Name | 11-[(2-chloro-5-fluoro-3-pyridinyl)methyl]-15-ethyl-8-oxa-6,11-diazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2(7),3,5,12(17),13,15-heptaen-9-one |
|---|---|
| PubChem CID | 25217489 |
| Molecular Formula | C22H15ClFN3O2 |
| Molecular Weight | 407.83 g/mol |
| Exact Mass | 407.08 |
| IUPAC Name | 11-[(2-chloro-5-fluoro-3-pyridinyl)methyl]-15-ethyl-8-oxa-6,11-diazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2(7),3,5,12(17),13,15-heptaen-9-one |
| SMILES | CCc1ccc2c(c1)c1c3cccnc3oc(=O)c1n2Cc1cc(F)cnc1Cl |
| InChI | InChI=1S/C22H15ClFN3O2/c1-2-12-5-6-17-16(8-12)18-15-4-3-7-25-21(15)29-22(28)19(18)27(17)11-13-9-14(24)10-26-20(13)23/h3-10H,2,11H2,1H3 |
| InChIKey | FDQLFSPXOXGQIO-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 60.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.83 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|