C27H26F4N4O5 — CID 25221392
5-fluoro-10-(3-hydroxyphenyl)-13-(2-morpholin-4-ylethyl)-4-(2,2,2-trifluoroethoxy)-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6-tetraene-12,14-dione (PubChem CID 25221392) has the molecular formula C27H26F4N4O5 and a molecular weight of 562.52 g/mol. Its IUPAC name is 5-fluoro-10-(3-hydroxyphenyl)-13-(2-morpholin-4-ylethyl)-4-(2,2,2-trifluoroethoxy)-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6-tetraene-12,14-dione.
| Compound Name | 5-fluoro-10-(3-hydroxyphenyl)-13-(2-morpholin-4-ylethyl)-4-(2,2,2-trifluoroethoxy)-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6-tetraene-12,14-dione |
|---|---|
| PubChem CID | 25221392 |
| Molecular Formula | C27H26F4N4O5 |
| Molecular Weight | 562.52 g/mol |
| Exact Mass | 562.18 |
| IUPAC Name | 5-fluoro-10-(3-hydroxyphenyl)-13-(2-morpholin-4-ylethyl)-4-(2,2,2-trifluoroethoxy)-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6-tetraene-12,14-dione |
| SMILES | O=C1C2Cc3c([nH]c4cc(F)c(OCC(F)(F)F)cc34)C(c3cccc(O)c3)N2C(=O)N1CCN1CCOCC1 |
| InChI | InChI=1S/C27H26F4N4O5/c28-19-13-20-17(12-22(19)40-14-27(29,30)31)18-11-21-25(37)34(5-4-33-6-8-39-9-7-33)26(38)35(21)24(23(18)32-20)15-2-1-3-16(36)10-15/h1-3,10,12-13,21,24,32,36H,4-9,11,14H2 |
| InChIKey | AVXXQFPLWNHOGY-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 98.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.52 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|