C21H18FN3O3 — CID 25222291
3-fluoro-10-(3-hydroxyphenyl)-4,13-dimethyl-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2(7),3,5-tetraene-12,14-dione (PubChem CID 25222291) has the molecular formula C21H18FN3O3 and a molecular weight of 379.39 g/mol. Its IUPAC name is 3-fluoro-10-(3-hydroxyphenyl)-4,13-dimethyl-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2(7),3,5-tetraene-12,14-dione.
| Compound Name | 3-fluoro-10-(3-hydroxyphenyl)-4,13-dimethyl-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2(7),3,5-tetraene-12,14-dione |
|---|---|
| PubChem CID | 25222291 |
| Molecular Formula | C21H18FN3O3 |
| Molecular Weight | 379.39 g/mol |
| Exact Mass | 379.13 |
| IUPAC Name | 3-fluoro-10-(3-hydroxyphenyl)-4,13-dimethyl-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2(7),3,5-tetraene-12,14-dione |
| SMILES | Cc1ccc2[nH]c3c(c2c1F)CC1C(=O)N(C)C(=O)N1C3c1cccc(O)c1 |
| InChI | InChI=1S/C21H18FN3O3/c1-10-6-7-14-16(17(10)22)13-9-15-20(27)24(2)21(28)25(15)19(18(13)23-14)11-4-3-5-12(26)8-11/h3-8,15,19,23,26H,9H2,1-2H3 |
| InChIKey | NYAIPJWIFNRZRA-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 76.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.39 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|