C26H17N5O2S2 — CID 25227408
4,6-dimethyl-N-phenylpyrimidin-2-amine;5,10-dioxobenzo[g][1,4]benzodithiine-2,3-dicarbonitrile (PubChem CID 25227408) has the molecular formula C26H17N5O2S2 and a molecular weight of 495.59 g/mol. Its IUPAC name is 4,6-dimethyl-N-phenylpyrimidin-2-amine;5,10-dioxobenzo[g][1,4]benzodithiine-2,3-dicarbonitrile.
| Compound Name | 4,6-dimethyl-N-phenylpyrimidin-2-amine;5,10-dioxobenzo[g][1,4]benzodithiine-2,3-dicarbonitrile |
|---|---|
| PubChem CID | 25227408 |
| Molecular Formula | C26H17N5O2S2 |
| Molecular Weight | 495.59 g/mol |
| Exact Mass | 495.08 |
| IUPAC Name | 4,6-dimethyl-N-phenylpyrimidin-2-amine;5,10-dioxobenzo[g][1,4]benzodithiine-2,3-dicarbonitrile |
| SMILES | Cc1cc(C)nc(Nc2ccccc2)n1.N#Cc1sc2c(=O)c3ccccc3c(=O)c=2sc1C#N |
| InChI | InChI=1S/C14H4N2O2S2.C12H13N3/c15-5-9-10(6-16)20-14-12(18)8-4-2-1-3-7(8)11(17)13(14)19-9;1-9-8-10(2)14-12(13-9)15-11-6-4-3-5-7-11/h1-4H;3-8H,1-2H3,(H,13,14,15) |
| InChIKey | CWTVCXOOCSRQRL-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 119.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.59 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|