C19H14Br2NO2P — CID 25243501
5-bromo-N-(4-bromophenyl)-2-oxo-2-phenyl-3H-1,2λ5-benzoxaphosphol-3-amine (PubChem CID 25243501) has the molecular formula C19H14Br2NO2P and a molecular weight of 479.11 g/mol. Its IUPAC name is 5-bromo-N-(4-bromophenyl)-2-oxo-2-phenyl-3H-1,2λ5-benzoxaphosphol-3-amine.
| Compound Name | 5-bromo-N-(4-bromophenyl)-2-oxo-2-phenyl-3H-1,2λ5-benzoxaphosphol-3-amine |
|---|---|
| PubChem CID | 25243501 |
| Molecular Formula | C19H14Br2NO2P |
| Molecular Weight | 479.11 g/mol |
| Exact Mass | 476.91 |
| IUPAC Name | 5-bromo-N-(4-bromophenyl)-2-oxo-2-phenyl-3H-1,2λ5-benzoxaphosphol-3-amine |
| SMILES | O=P1(c2ccccc2)Oc2ccc(Br)cc2C1Nc1ccc(Br)cc1 |
| InChI | InChI=1S/C19H14Br2NO2P/c20-13-6-9-15(10-7-13)22-19-17-12-14(21)8-11-18(17)24-25(19,23)16-4-2-1-3-5-16/h1-12,19,22H |
| InChIKey | PWJDGMBQZVLJFL-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.11 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|