C23H25N5O5S2 — CID 25251005
N-[(E)-[2-[2-(3-ethyl-5-methylphenoxy)ethoxy]-5-nitrophenyl]methylideneamino]-2-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]acetamide (PubChem CID 25251005) has the molecular formula C23H25N5O5S2 and a molecular weight of 515.62 g/mol. Its IUPAC name is N-[(E)-[2-[2-(3-ethyl-5-methylphenoxy)ethoxy]-5-nitrophenyl]methylideneamino]-2-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]acetamide.
| Compound Name | N-[(E)-[2-[2-(3-ethyl-5-methylphenoxy)ethoxy]-5-nitrophenyl]methylideneamino]-2-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 25251005 |
| Molecular Formula | C23H25N5O5S2 |
| Molecular Weight | 515.62 g/mol |
| Exact Mass | 515.13 |
| IUPAC Name | N-[(E)-[2-[2-(3-ethyl-5-methylphenoxy)ethoxy]-5-nitrophenyl]methylideneamino]-2-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]acetamide |
| SMILES | CCc1cc(C)cc(OCCOc2ccc([N+](=O)[O-])cc2/C=N/NC(=O)CSc2nnc(C)s2)c1 |
| InChI | InChI=1S/C23H25N5O5S2/c1-4-17-9-15(2)10-20(11-17)32-7-8-33-21-6-5-19(28(30)31)12-18(21)13-24-26-22(29)14-34-23-27-25-16(3)35-23/h5-6,9-13H,4,7-8,14H2,1-3H3,(H,26,29)/b24-13+ |
| InChIKey | FWCSYNQIJSSZOB-ZMOGYAJESA-N |
| XLogP | 4.33 |
| TPSA | 128.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.62 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|