C18H26N2OS — CID 25257601
2-[4-tert-butyl-2-(1-phenylpropylimino)-1,3-thiazol-3-yl]ethanol (PubChem CID 25257601) has the molecular formula C18H26N2OS and a molecular weight of 318.49 g/mol. Its IUPAC name is 2-[4-tert-butyl-2-(1-phenylpropylimino)-1,3-thiazol-3-yl]ethanol.
| Compound Name | 2-[4-tert-butyl-2-(1-phenylpropylimino)-1,3-thiazol-3-yl]ethanol |
|---|---|
| PubChem CID | 25257601 |
| Molecular Formula | C18H26N2OS |
| Molecular Weight | 318.49 g/mol |
| Exact Mass | 318.18 |
| IUPAC Name | 2-[4-tert-butyl-2-(1-phenylpropylimino)-1,3-thiazol-3-yl]ethanol |
| SMILES | CCC(/N=c1\scc(C(C)(C)C)n1CCO)c1ccccc1 |
| InChI | InChI=1S/C18H26N2OS/c1-5-15(14-9-7-6-8-10-14)19-17-20(11-12-21)16(13-22-17)18(2,3)4/h6-10,13,15,21H,5,11-12H2,1-4H3/b19-17- |
| InChIKey | PZFSIKKOGSHSRF-ZPHPHTNESA-N |
| XLogP | 3.89 |
| TPSA | 37.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.49 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |