C25H24N2O5S — CID 25261619
2-[3-[1-[4-(1-hydroxy-2-phenylethyl)phenyl]-3,5-dioxopyrrolidin-2-yl]propyl]-1,3-thiazole-5-carboxylic acid (PubChem CID 25261619) has the molecular formula C25H24N2O5S and a molecular weight of 464.54 g/mol. Its IUPAC name is 2-[3-[1-[4-(1-hydroxy-2-phenylethyl)phenyl]-3,5-dioxopyrrolidin-2-yl]propyl]-1,3-thiazole-5-carboxylic acid.
| Compound Name | 2-[3-[1-[4-(1-hydroxy-2-phenylethyl)phenyl]-3,5-dioxopyrrolidin-2-yl]propyl]-1,3-thiazole-5-carboxylic acid |
|---|---|
| PubChem CID | 25261619 |
| Molecular Formula | C25H24N2O5S |
| Molecular Weight | 464.54 g/mol |
| Exact Mass | 464.14 |
| IUPAC Name | 2-[3-[1-[4-(1-hydroxy-2-phenylethyl)phenyl]-3,5-dioxopyrrolidin-2-yl]propyl]-1,3-thiazole-5-carboxylic acid |
| SMILES | O=C(O)c1cnc(CCCC2C(=O)CC(=O)N2c2ccc(C(O)Cc3ccccc3)cc2)s1 |
| InChI | InChI=1S/C25H24N2O5S/c28-20(13-16-5-2-1-3-6-16)17-9-11-18(12-10-17)27-19(21(29)14-24(27)30)7-4-8-23-26-15-22(33-23)25(31)32/h1-3,5-6,9-12,15,19-20,28H,4,7-8,13-14H2,(H,31,32) |
| InChIKey | YKKOXFZFSOZREI-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 107.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.54 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|