C17H22N6O3S — CID 25267610
2-butylsulfanyl-4-(dimethylamino)-8-[(5-methyl-1,2-oxazol-3-yl)methyl]-5H-pteridine-6,7-dione (PubChem CID 25267610) has the molecular formula C17H22N6O3S and a molecular weight of 390.47 g/mol. Its IUPAC name is 2-butylsulfanyl-4-(dimethylamino)-8-[(5-methyl-1,2-oxazol-3-yl)methyl]-5H-pteridine-6,7-dione.
| Compound Name | 2-butylsulfanyl-4-(dimethylamino)-8-[(5-methyl-1,2-oxazol-3-yl)methyl]-5H-pteridine-6,7-dione |
|---|---|
| PubChem CID | 25267610 |
| Molecular Formula | C17H22N6O3S |
| Molecular Weight | 390.47 g/mol |
| Exact Mass | 390.15 |
| IUPAC Name | 2-butylsulfanyl-4-(dimethylamino)-8-[(5-methyl-1,2-oxazol-3-yl)methyl]-5H-pteridine-6,7-dione |
| SMILES | CCCCSc1nc(N(C)C)c2[nH]c(=O)c(=O)n(Cc3cc(C)on3)c2n1 |
| InChI | InChI=1S/C17H22N6O3S/c1-5-6-7-27-17-19-13(22(3)4)12-14(20-17)23(16(25)15(24)18-12)9-11-8-10(2)26-21-11/h8H,5-7,9H2,1-4H3,(H,18,24) |
| InChIKey | CZPHSQIKPSYCMD-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 109.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.47 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|