C18H18Cl2N4O3 — CID 25267259
2-butoxy-8-[(3,4-dichlorophenyl)methyl]-4-methyl-5H-pteridine-6,7-dione (PubChem CID 25267259) has the molecular formula C18H18Cl2N4O3 and a molecular weight of 409.27 g/mol. Its IUPAC name is 2-butoxy-8-[(3,4-dichlorophenyl)methyl]-4-methyl-5H-pteridine-6,7-dione.
| Compound Name | 2-butoxy-8-[(3,4-dichlorophenyl)methyl]-4-methyl-5H-pteridine-6,7-dione |
|---|---|
| PubChem CID | 25267259 |
| Molecular Formula | C18H18Cl2N4O3 |
| Molecular Weight | 409.27 g/mol |
| Exact Mass | 408.08 |
| IUPAC Name | 2-butoxy-8-[(3,4-dichlorophenyl)methyl]-4-methyl-5H-pteridine-6,7-dione |
| SMILES | CCCCOc1nc(C)c2[nH]c(=O)c(=O)n(Cc3ccc(Cl)c(Cl)c3)c2n1 |
| InChI | InChI=1S/C18H18Cl2N4O3/c1-3-4-7-27-18-21-10(2)14-15(23-18)24(17(26)16(25)22-14)9-11-5-6-12(19)13(20)8-11/h5-6,8H,3-4,7,9H2,1-2H3,(H,22,25) |
| InChIKey | UTNWDFFGTFVTGW-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.27 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|