C19H22FN5O4S2 — CID 25268323
N-[2-butylsulfanyl-8-[(4-fluorophenyl)methyl]-6,7-dioxo-5H-pteridin-4-yl]-N-methylmethanesulfonamide (PubChem CID 25268323) has the molecular formula C19H22FN5O4S2 and a molecular weight of 467.55 g/mol. Its IUPAC name is N-[2-butylsulfanyl-8-[(4-fluorophenyl)methyl]-6,7-dioxo-5H-pteridin-4-yl]-N-methylmethanesulfonamide.
| Compound Name | N-[2-butylsulfanyl-8-[(4-fluorophenyl)methyl]-6,7-dioxo-5H-pteridin-4-yl]-N-methylmethanesulfonamide |
|---|---|
| PubChem CID | 25268323 |
| Molecular Formula | C19H22FN5O4S2 |
| Molecular Weight | 467.55 g/mol |
| Exact Mass | 467.11 |
| IUPAC Name | N-[2-butylsulfanyl-8-[(4-fluorophenyl)methyl]-6,7-dioxo-5H-pteridin-4-yl]-N-methylmethanesulfonamide |
| SMILES | CCCCSc1nc(N(C)S(C)(=O)=O)c2[nH]c(=O)c(=O)n(Cc3ccc(F)cc3)c2n1 |
| InChI | InChI=1S/C19H22FN5O4S2/c1-4-5-10-30-19-22-15(24(2)31(3,28)29)14-16(23-19)25(18(27)17(26)21-14)11-12-6-8-13(20)9-7-12/h6-9H,4-5,10-11H2,1-3H3,(H,21,26) |
| InChIKey | WJKHZXGNWPFVKS-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 118.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.55 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|