C29H29N7O — CID 25271522
4-[2-(2-methyl-3-propan-2-ylbenzimidazol-4-yl)ethynyl]-N-(4-morpholin-4-ylphenyl)-7H-pyrrolo[2,3-d]pyrimidin-2-amine (PubChem CID 25271522) has the molecular formula C29H29N7O and a molecular weight of 491.60 g/mol. Its IUPAC name is 4-[2-(2-methyl-3-propan-2-ylbenzimidazol-4-yl)ethynyl]-N-(4-morpholin-4-ylphenyl)-7H-pyrrolo[2,3-d]pyrimidin-2-amine.
| Compound Name | 4-[2-(2-methyl-3-propan-2-ylbenzimidazol-4-yl)ethynyl]-N-(4-morpholin-4-ylphenyl)-7H-pyrrolo[2,3-d]pyrimidin-2-amine |
|---|---|
| PubChem CID | 25271522 |
| Molecular Formula | C29H29N7O |
| Molecular Weight | 491.60 g/mol |
| Exact Mass | 491.24 |
| IUPAC Name | 4-[2-(2-methyl-3-propan-2-ylbenzimidazol-4-yl)ethynyl]-N-(4-morpholin-4-ylphenyl)-7H-pyrrolo[2,3-d]pyrimidin-2-amine |
| SMILES | Cc1nc2cccc(C#Cc3nc(Nc4ccc(N5CCOCC5)cc4)nc4[nH]ccc34)c2n1C(C)C |
| InChI | InChI=1S/C29H29N7O/c1-19(2)36-20(3)31-26-6-4-5-21(27(26)36)7-12-25-24-13-14-30-28(24)34-29(33-25)32-22-8-10-23(11-9-22)35-15-17-37-18-16-35/h4-6,8-11,13-14,19H,15-18H2,1-3H3,(H2,30,32,33,34) |
| InChIKey | NEWLYJVRDCXHAG-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 83.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.60 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|