C18H31N3O5S — CID 25285266
ethyl 2-[(3R)-4-[(3-butyl-2-ethylsulfonylimidazol-4-yl)methyl]morpholin-3-yl]acetate (PubChem CID 25285266) has the molecular formula C18H31N3O5S and a molecular weight of 401.53 g/mol. Its IUPAC name is ethyl 2-[(3R)-4-[(3-butyl-2-ethylsulfonylimidazol-4-yl)methyl]morpholin-3-yl]acetate.
| Compound Name | ethyl 2-[(3R)-4-[(3-butyl-2-ethylsulfonylimidazol-4-yl)methyl]morpholin-3-yl]acetate |
|---|---|
| PubChem CID | 25285266 |
| Molecular Formula | C18H31N3O5S |
| Molecular Weight | 401.53 g/mol |
| Exact Mass | 401.20 |
| IUPAC Name | ethyl 2-[(3R)-4-[(3-butyl-2-ethylsulfonylimidazol-4-yl)methyl]morpholin-3-yl]acetate |
| SMILES | CCCCn1c(CN2CCOC[C@H]2CC(=O)OCC)cnc1S(=O)(=O)CC |
| InChI | InChI=1S/C18H31N3O5S/c1-4-7-8-21-16(12-19-18(21)27(23,24)6-3)13-20-9-10-25-14-15(20)11-17(22)26-5-2/h12,15H,4-11,13-14H2,1-3H3/t15-/m1/s1 |
| InChIKey | RKANAZURCQMKJD-OAHLLOKOSA-N |
| XLogP | 1.63 |
| TPSA | 90.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.53 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |