C24H21N3O9S — CID 2529292
[2-[(3S)-3-(furan-2-yl)-5-(4-methoxyphenyl)-1,3-dihydropyrazol-2-yl]-2-oxoethyl] 4-methylsulfonyl-3-nitrobenzoate (PubChem CID 2529292) has the molecular formula C24H21N3O9S and a molecular weight of 527.51 g/mol. Its IUPAC name is [2-[(3S)-3-(furan-2-yl)-5-(4-methoxyphenyl)-1,3-dihydropyrazol-2-yl]-2-oxoethyl] 4-methylsulfonyl-3-nitrobenzoate.
| Compound Name | [2-[(3S)-3-(furan-2-yl)-5-(4-methoxyphenyl)-1,3-dihydropyrazol-2-yl]-2-oxoethyl] 4-methylsulfonyl-3-nitrobenzoate |
|---|---|
| PubChem CID | 2529292 |
| Molecular Formula | C24H21N3O9S |
| Molecular Weight | 527.51 g/mol |
| Exact Mass | 527.10 |
| IUPAC Name | [2-[(3S)-3-(furan-2-yl)-5-(4-methoxyphenyl)-1,3-dihydropyrazol-2-yl]-2-oxoethyl] 4-methylsulfonyl-3-nitrobenzoate |
| SMILES | COc1ccc(C2=C[C@@H](c3ccco3)N(C(=O)COC(=O)c3ccc(S(C)(=O)=O)c([N+](=O)[O-])c3)N2)cc1 |
| InChI | InChI=1S/C24H21N3O9S/c1-34-17-8-5-15(6-9-17)18-13-19(21-4-3-11-35-21)26(25-18)23(28)14-36-24(29)16-7-10-22(37(2,32)33)20(12-16)27(30)31/h3-13,19,25H,14H2,1-2H3/t19-/m0/s1 |
| InChIKey | WMEKIFSIAHNMCV-IBGZPJMESA-N |
| XLogP | 2.89 |
| TPSA | 158.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.51 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|