C18H29N3O4 — CID 25314698
(1S,2S,3S,4R,5R)-2-[[4-(dimethylamino)phenyl]methylamino]-4-(2-methoxyethylamino)-6,8-dioxabicyclo[3.2.1]octan-3-ol (PubChem CID 25314698) has the molecular formula C18H29N3O4 and a molecular weight of 351.45 g/mol. Its IUPAC name is (1S,2S,3S,4R,5R)-2-[[4-(dimethylamino)phenyl]methylamino]-4-(2-methoxyethylamino)-6,8-dioxabicyclo[3.2.1]octan-3-ol.
| Compound Name | (1S,2S,3S,4R,5R)-2-[[4-(dimethylamino)phenyl]methylamino]-4-(2-methoxyethylamino)-6,8-dioxabicyclo[3.2.1]octan-3-ol |
|---|---|
| PubChem CID | 25314698 |
| Molecular Formula | C18H29N3O4 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.22 |
| IUPAC Name | (1S,2S,3S,4R,5R)-2-[[4-(dimethylamino)phenyl]methylamino]-4-(2-methoxyethylamino)-6,8-dioxabicyclo[3.2.1]octan-3-ol |
| SMILES | COCCN[C@H]1[C@@H]2OC[C@@H](O2)[C@@H](NCc2ccc(N(C)C)cc2)[C@@H]1O |
| InChI | InChI=1S/C18H29N3O4/c1-21(2)13-6-4-12(5-7-13)10-20-15-14-11-24-18(25-14)16(17(15)22)19-8-9-23-3/h4-7,14-20,22H,8-11H2,1-3H3/t14-,15-,16-,17+,18-/m1/s1 |
| InChIKey | XFXAMLOKYITYLH-HSFUPAIVSA-N |
| XLogP | -0.07 |
| TPSA | 75.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|