C19H19F2N3O4S — CID 25330309
methyl 3-[[(1S)-1-[1-(difluoromethyl)benzimidazol-2-yl]ethyl]sulfamoyl]-4-methylbenzoate (PubChem CID 25330309) has the molecular formula C19H19F2N3O4S and a molecular weight of 423.44 g/mol. Its IUPAC name is methyl 3-[[(1S)-1-[1-(difluoromethyl)benzimidazol-2-yl]ethyl]sulfamoyl]-4-methylbenzoate.
| Compound Name | methyl 3-[[(1S)-1-[1-(difluoromethyl)benzimidazol-2-yl]ethyl]sulfamoyl]-4-methylbenzoate |
|---|---|
| PubChem CID | 25330309 |
| Molecular Formula | C19H19F2N3O4S |
| Molecular Weight | 423.44 g/mol |
| Exact Mass | 423.11 |
| IUPAC Name | methyl 3-[[(1S)-1-[1-(difluoromethyl)benzimidazol-2-yl]ethyl]sulfamoyl]-4-methylbenzoate |
| SMILES | COC(=O)c1ccc(C)c(S(=O)(=O)N[C@@H](C)c2nc3ccccc3n2C(F)F)c1 |
| InChI | InChI=1S/C19H19F2N3O4S/c1-11-8-9-13(18(25)28-3)10-16(11)29(26,27)23-12(2)17-22-14-6-4-5-7-15(14)24(17)19(20)21/h4-10,12,19,23H,1-3H3/t12-/m0/s1 |
| InChIKey | AZEVFHAFQUWNMI-LBPRGKRZSA-N |
| XLogP | 3.57 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.44 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |