C19H19BrClNO5S — CID 25331653
[(2R)-oxolan-2-yl]methyl 5-[(2-bromo-5-methylphenyl)sulfamoyl]-2-chlorobenzoate (PubChem CID 25331653) has the molecular formula C19H19BrClNO5S and a molecular weight of 488.79 g/mol. Its IUPAC name is [(2R)-oxolan-2-yl]methyl 5-[(2-bromo-5-methylphenyl)sulfamoyl]-2-chlorobenzoate.
| Compound Name | [(2R)-oxolan-2-yl]methyl 5-[(2-bromo-5-methylphenyl)sulfamoyl]-2-chlorobenzoate |
|---|---|
| PubChem CID | 25331653 |
| Molecular Formula | C19H19BrClNO5S |
| Molecular Weight | 488.79 g/mol |
| Exact Mass | 486.99 |
| IUPAC Name | [(2R)-oxolan-2-yl]methyl 5-[(2-bromo-5-methylphenyl)sulfamoyl]-2-chlorobenzoate |
| SMILES | Cc1ccc(Br)c(NS(=O)(=O)c2ccc(Cl)c(C(=O)OC[C@H]3CCCO3)c2)c1 |
| InChI | InChI=1S/C19H19BrClNO5S/c1-12-4-6-16(20)18(9-12)22-28(24,25)14-5-7-17(21)15(10-14)19(23)27-11-13-3-2-8-26-13/h4-7,9-10,13,22H,2-3,8,11H2,1H3/t13-/m1/s1 |
| InChIKey | FDVBHRJHVNYTJH-CYBMUJFWSA-N |
| XLogP | 4.55 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.79 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |